About 2-fluoro-1-methylimidazole-4,5-dicarbonitrile
2-fluoro-1-methylimidazole-4,5-dicarbonitrile (PubChem CID 10773133) has the molecular formula C6H3FN4
and a molecular weight of 150.12 g/mol. Its IUPAC name is 2-fluoro-1-methylimidazole-4,5-dicarbonitrile.
Analyze 2-fluoro-1-methylimidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-methylimidazole-4,5-dicarbonitrile?
The IUPAC name of 2-fluoro-1-methylimidazole-4,5-dicarbonitrile (CID 10773133) is 2-fluoro-1-methylimidazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-fluoro-1-methylimidazole-4,5-dicarbonitrile?
The canonical SMILES for 2-fluoro-1-methylimidazole-4,5-dicarbonitrile is Cn1c(F)nc(C#N)c1C#N.
What is the InChIKey of 2-fluoro-1-methylimidazole-4,5-dicarbonitrile?
The InChIKey is LCXLAUOBTOUXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3FN4/c1-11-5(3-9)4(2-8)10-6(11)7/h1H3.
What are the key properties of 2-fluoro-1-methylimidazole-4,5-dicarbonitrile?
2-fluoro-1-methylimidazole-4,5-dicarbonitrile has a molecular weight of 150.12 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-methylimidazole-4,5-dicarbonitrile is sourced from PubChem (CID 10773133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).