About 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile
2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile (PubChem CID 19016773) has the molecular formula C7H7N5
and a molecular weight of 161.17 g/mol. Its IUPAC name is 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile.
Analyze 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile?
The IUPAC name of 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile (CID 19016773) is 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile?
The canonical SMILES for 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile is CN(C)c1nc(C#N)c(C#N)[nH]1.
What is the InChIKey of 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile?
The InChIKey is IKOXXDLZIRTYRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5/c1-12(2)7-10-5(3-8)6(4-9)11-7/h1-2H3,(H,10,11).
What are the key properties of 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile?
2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile has a molecular weight of 161.17 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-1H-imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 19016773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).