C25H25Cl2NO2 — CID 58328983
6-(3,4-dichloroanilino)-1-(4-phenylmethoxyphenyl)hexan-3-one (PubChem CID 58328983) has the molecular formula C25H25Cl2NO2 and a molecular weight of 442.39 g/mol. Its IUPAC name is 6-(3,4-dichloroanilino)-1-(4-phenylmethoxyphenyl)hexan-3-one.
| Compound Name | 6-(3,4-dichloroanilino)-1-(4-phenylmethoxyphenyl)hexan-3-one |
|---|---|
| PubChem CID | 58328983 |
| Molecular Formula | C25H25Cl2NO2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 6-(3,4-dichloroanilino)-1-(4-phenylmethoxyphenyl)hexan-3-one |
| SMILES | O=C(CCCNc1ccc(Cl)c(Cl)c1)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25Cl2NO2/c26-24-15-11-21(17-25(24)27)28-16-4-7-22(29)12-8-19-9-13-23(14-10-19)30-18-20-5-2-1-3-6-20/h1-3,5-6,9-11,13-15,17,28H,4,7-8,12,16,18H2 |
| InChIKey | WCAWFOUFHMTJCL-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|