C24H29ClN2O3 — CID 58329090
N'-[7-[4-(4-chlorobenzoyl)phenoxy]-7-methyl-6-oxooctyl]ethanimidamide (PubChem CID 58329090) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is N'-[7-[4-(4-chlorobenzoyl)phenoxy]-7-methyl-6-oxooctyl]ethanimidamide.
| Compound Name | N'-[7-[4-(4-chlorobenzoyl)phenoxy]-7-methyl-6-oxooctyl]ethanimidamide |
|---|---|
| PubChem CID | 58329090 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N'-[7-[4-(4-chlorobenzoyl)phenoxy]-7-methyl-6-oxooctyl]ethanimidamide |
| SMILES | C/C(N)=N\CCCCCC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H29ClN2O3/c1-17(26)27-16-6-4-5-7-22(28)24(2,3)30-21-14-10-19(11-15-21)23(29)18-8-12-20(25)13-9-18/h8-15H,4-7,16H2,1-3H3,(H2,26,27) |
| InChIKey | KEPPCWABAIUQFE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|