C24H27NO3 — CID 58329207
4-[2-methoxy-5-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]phenoxy]aniline (PubChem CID 58329207) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 4-[2-methoxy-5-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]phenoxy]aniline.
| Compound Name | 4-[2-methoxy-5-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]phenoxy]aniline |
|---|---|
| PubChem CID | 58329207 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-[2-methoxy-5-[1-(3-methoxy-4,5-dimethylphenyl)ethyl]phenoxy]aniline |
| SMILES | COc1ccc(C(C)c2cc(C)c(C)c(OC)c2)cc1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-15-12-19(14-23(27-5)16(15)2)17(3)18-6-11-22(26-4)24(13-18)28-21-9-7-20(25)8-10-21/h6-14,17H,25H2,1-5H3 |
| InChIKey | GSEXSFSPGQKPEY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|