C69H87N9O10S3 — CID 58331074
CID 58331074 (PubChem CID 58331074) has the molecular formula C69H87N9O10S3 and a molecular weight of 1298.71 g/mol.
| Compound Name | CID 58331074 |
|---|---|
| PubChem CID | 58331074 |
| Molecular Formula | C69H87N9O10S3 |
| Molecular Weight | 1298.71 g/mol |
| Exact Mass | 1297.57 |
| IUPAC Name | — |
| SMILES | [CH]CCN1c2ccc3c(S(=O)(=O)N(C)CCCC(=O)NC([CH])C(=O)NCc4cc5c(nc4CCCCCC[C@@H]([CH])c4cnc(C)nc4)NCCC5)cccc3c2C(C)(C)C1CCCCCC1=[N+](CCCS(=O)(=O)[O-])c2ccc3ccc(S(=O)(=O)O)cc3c2C1(C)C |
| InChI | InChI=1S/C69H87N9O10S3/c1-10-37-77-59-35-33-54-55(64(59)68(5,6)61(77)27-16-13-17-28-62-69(7,8)65-56-42-53(91(86,87)88)32-30-49(56)31-34-58(65)78(62)39-21-40-89(81,82)83)24-18-26-60(54)90(84,85)76(9)38-20-29-63(79)74-47(3)67(80)73-43-51-41-50-23-19-36-70-66(50)75-57(51)25-15-12-11-14-22-46(2)52-44-71-48(4)72-45-52/h1-3,18,24,26,30-35,41-42,44-47,61H,10-17,19-23,25,27-29,36-40,43H2,4-9H3,(H4-,70,73,74,75,79,80,81,82,83,86,87,88)/t46-,47?,61?/m1/s1 |
| InChIKey | DMEZMSNUESOFQS-CPAFNRHGSA-N |
| XLogP | 10.52 |
| TPSA | 264.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1298.71 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|