C28H51N3O4 — CID 58333049
(4S,10S,17S)-11,17-dimethyl-4-propan-2-yl-10-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]-1,5,11-triazacycloheptadecane-3,9,16-trione (PubChem CID 58333049) has the molecular formula C28H51N3O4 and a molecular weight of 496.75 g/mol. Its IUPAC name is (4S,10S,17S)-11,17-dimethyl-4-propan-2-yl-10-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]-1,5,11-triazacycloheptadecane-3,9,16-trione.
| Compound Name | (4S,10S,17S)-11,17-dimethyl-4-propan-2-yl-10-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]-1,5,11-triazacycloheptadecane-3,9,16-trione |
|---|---|
| PubChem CID | 58333049 |
| Molecular Formula | C28H51N3O4 |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 496.41 |
| IUPAC Name | (4S,10S,17S)-11,17-dimethyl-4-propan-2-yl-10-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]-1,5,11-triazacycloheptadecane-3,9,16-trione |
| SMILES | [2H]C([2H])([2H])CC/C=C/C[C@@H](C)C(O)[C@H]1C(=O)CCCN[C@@H](C(C)C)C(=O)CN[C@@H](C)C(=O)CCCCN1C |
| InChI | InChI=1S/C28H51N3O4/c1-7-8-9-10-14-21(4)28(35)27-24(33)16-13-17-29-26(20(2)3)25(34)19-30-22(5)23(32)15-11-12-18-31(27)6/h9-10,20-22,26-30,35H,7-8,11-19H2,1-6H3/b10-9+/t21-,22+,26+,27-,28?/m1/s1/i1D3 |
| InChIKey | WBXYIJCJOBEXTQ-QHEQNURGSA-N |
| XLogP | 3.29 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|