C8H18N2 — CID 15939300
(2S)-1-methyl-2-propan-2-yl-1,3-diazinane (PubChem CID 15939300) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is (2S)-1-methyl-2-propan-2-yl-1,3-diazinane.
| Compound Name | (2S)-1-methyl-2-propan-2-yl-1,3-diazinane |
|---|---|
| PubChem CID | 15939300 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (2S)-1-methyl-2-propan-2-yl-1,3-diazinane |
| SMILES | CC(C)[C@H]1NCCCN1C |
| InChI | InChI=1S/C8H18N2/c1-7(2)8-9-5-4-6-10(8)3/h7-9H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | FQYGZLVGCCOGSD-QMMMGPOBSA-N |
| XLogP | 0.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |