C15H27NO — CID 58333061
(2S)-2-[(E,3R)-8,8-dideuterio-3-methyloct-5-en-2-yl]-1-methylpiperidin-3-one (PubChem CID 58333061) has the molecular formula C15H27NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (2S)-2-[(E,3R)-8,8-dideuterio-3-methyloct-5-en-2-yl]-1-methylpiperidin-3-one.
| Compound Name | (2S)-2-[(E,3R)-8,8-dideuterio-3-methyloct-5-en-2-yl]-1-methylpiperidin-3-one |
|---|---|
| PubChem CID | 58333061 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (2S)-2-[(E,3R)-8,8-dideuterio-3-methyloct-5-en-2-yl]-1-methylpiperidin-3-one |
| SMILES | [2H]C([2H])C/C=C/C[C@@H](C)C(C)[C@H]1C(=O)CCCN1C |
| InChI | InChI=1S/C15H27NO/c1-5-6-7-9-12(2)13(3)15-14(17)10-8-11-16(15)4/h6-7,12-13,15H,5,8-11H2,1-4H3/b7-6+/t12-,13?,15+/m1/s1/i1D2 |
| InChIKey | AAJZKCANIBOZBW-YEIPUNQMSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|