C16H29NO — CID 58333064
(2S)-1-methyl-2-[(E,3R)-9,9,9-trideuterio-3-methylnon-5-en-2-yl]piperidin-3-one (PubChem CID 58333064) has the molecular formula C16H29NO and a molecular weight of 254.43 g/mol. Its IUPAC name is (2S)-1-methyl-2-[(E,3R)-9,9,9-trideuterio-3-methylnon-5-en-2-yl]piperidin-3-one.
| Compound Name | (2S)-1-methyl-2-[(E,3R)-9,9,9-trideuterio-3-methylnon-5-en-2-yl]piperidin-3-one |
|---|---|
| PubChem CID | 58333064 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 254.43 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (2S)-1-methyl-2-[(E,3R)-9,9,9-trideuterio-3-methylnon-5-en-2-yl]piperidin-3-one |
| SMILES | [2H]C([2H])([2H])CC/C=C/C[C@@H](C)C(C)[C@H]1C(=O)CCCN1C |
| InChI | InChI=1S/C16H29NO/c1-5-6-7-8-10-13(2)14(3)16-15(18)11-9-12-17(16)4/h7-8,13-14,16H,5-6,9-12H2,1-4H3/b8-7+/t13-,14?,16+/m1/s1/i1D3 |
| InChIKey | DTWDJPBJIVECHO-ACQYYDOTSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|