C27H30N2O — CID 58335434
1-[4-(2-methyl-4-pyridinyl)phenyl]-3-(4-piperidin-1-ylphenyl)butan-2-one (PubChem CID 58335434) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[4-(2-methyl-4-pyridinyl)phenyl]-3-(4-piperidin-1-ylphenyl)butan-2-one.
| Compound Name | 1-[4-(2-methyl-4-pyridinyl)phenyl]-3-(4-piperidin-1-ylphenyl)butan-2-one |
|---|---|
| PubChem CID | 58335434 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[4-(2-methyl-4-pyridinyl)phenyl]-3-(4-piperidin-1-ylphenyl)butan-2-one |
| SMILES | Cc1cc(-c2ccc(CC(=O)C(C)c3ccc(N4CCCCC4)cc3)cc2)ccn1 |
| InChI | InChI=1S/C27H30N2O/c1-20-18-25(14-15-28-20)24-8-6-22(7-9-24)19-27(30)21(2)23-10-12-26(13-11-23)29-16-4-3-5-17-29/h6-15,18,21H,3-5,16-17,19H2,1-2H3 |
| InChIKey | ZMWCCNZSAMKLJK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|