C31H31N3O2 — CID 58335441
1-[4-(2-methyl-4-pyridinyl)phenyl]-3-[4-(4-morpholin-4-ylphenyl)-2-pyridinyl]butan-2-one (PubChem CID 58335441) has the molecular formula C31H31N3O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[4-(2-methyl-4-pyridinyl)phenyl]-3-[4-(4-morpholin-4-ylphenyl)-2-pyridinyl]butan-2-one.
| Compound Name | 1-[4-(2-methyl-4-pyridinyl)phenyl]-3-[4-(4-morpholin-4-ylphenyl)-2-pyridinyl]butan-2-one |
|---|---|
| PubChem CID | 58335441 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 1-[4-(2-methyl-4-pyridinyl)phenyl]-3-[4-(4-morpholin-4-ylphenyl)-2-pyridinyl]butan-2-one |
| SMILES | Cc1cc(-c2ccc(CC(=O)C(C)c3cc(-c4ccc(N5CCOCC5)cc4)ccn3)cc2)ccn1 |
| InChI | InChI=1S/C31H31N3O2/c1-22-19-27(11-13-32-22)25-5-3-24(4-6-25)20-31(35)23(2)30-21-28(12-14-33-30)26-7-9-29(10-8-26)34-15-17-36-18-16-34/h3-14,19,21,23H,15-18,20H2,1-2H3 |
| InChIKey | JRAMPBDJXULREV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |