C19H22FN5O2 — CID 58338105
N-(2-fluoro-4-methylphenyl)-5-methanimidoyl-6-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yloxy)pyrimidin-4-amine (PubChem CID 58338105) has the molecular formula C19H22FN5O2 and a molecular weight of 371.42 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-5-methanimidoyl-6-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yloxy)pyrimidin-4-amine.
| Compound Name | N-(2-fluoro-4-methylphenyl)-5-methanimidoyl-6-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yloxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 58338105 |
| Molecular Formula | C19H22FN5O2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-5-methanimidoyl-6-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yloxy)pyrimidin-4-amine |
| SMILES | [H]/N=C/c1c(Nc2ccc(C)cc2F)ncnc1OC1CC2COCC(C1)N2 |
| InChI | InChI=1S/C19H22FN5O2/c1-11-2-3-17(16(20)4-11)25-18-15(7-21)19(23-10-22-18)27-14-5-12-8-26-9-13(6-14)24-12/h2-4,7,10,12-14,21,24H,5-6,8-9H2,1H3,(H,22,23,25)/b21-7+ |
| InChIKey | ODJMPAQFFLHOGU-QPSGOUHRSA-N |
| XLogP | 2.56 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|