C17H19F2N5O — CID 142990335
N-(2,5-difluorophenyl)-5-methanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine (PubChem CID 142990335) has the molecular formula C17H19F2N5O and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-5-methanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine.
| Compound Name | N-(2,5-difluorophenyl)-5-methanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 142990335 |
| Molecular Formula | C17H19F2N5O |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-(2,5-difluorophenyl)-5-methanimidoyl-6-(1-methylpiperidin-4-yl)oxypyrimidin-4-amine |
| SMILES | [H]/N=C/c1c(Nc2cc(F)ccc2F)ncnc1OC1CCN(C)CC1 |
| InChI | InChI=1S/C17H19F2N5O/c1-24-6-4-12(5-7-24)25-17-13(9-20)16(21-10-22-17)23-15-8-11(18)2-3-14(15)19/h2-3,8-10,12,20H,4-7H2,1H3,(H,21,22,23)/b20-9+ |
| InChIKey | PCHHPTOGJSXWPF-AWQFTUOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|