C22H31NO5 — CID 58340233
2-[(4-butan-2-ylphenyl)methyl-[5-(2-methylprop-2-enoyloxy)-2-oxopentyl]amino]acetic acid (PubChem CID 58340233) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 2-[(4-butan-2-ylphenyl)methyl-[5-(2-methylprop-2-enoyloxy)-2-oxopentyl]amino]acetic acid.
| Compound Name | 2-[(4-butan-2-ylphenyl)methyl-[5-(2-methylprop-2-enoyloxy)-2-oxopentyl]amino]acetic acid |
|---|---|
| PubChem CID | 58340233 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-[(4-butan-2-ylphenyl)methyl-[5-(2-methylprop-2-enoyloxy)-2-oxopentyl]amino]acetic acid |
| SMILES | C=C(C)C(=O)OCCCC(=O)CN(CC(=O)O)Cc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C22H31NO5/c1-5-17(4)19-10-8-18(9-11-19)13-23(15-21(25)26)14-20(24)7-6-12-28-22(27)16(2)3/h8-11,17H,2,5-7,12-15H2,1,3-4H3,(H,25,26) |
| InChIKey | XHZMTWXTZRTROH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|