C29H45NO10 — CID 58695554
(2-hydroxy-4-prop-1-en-2-ylperoxybutyl) 2-[(4-butan-2-ylphenyl)methyl-[2-(2-hydroxy-4-prop-1-en-2-ylperoxybutoxy)-2-oxoethyl]amino]acetate (PubChem CID 58695554) has the molecular formula C29H45NO10 and a molecular weight of 567.68 g/mol. Its IUPAC name is (2-hydroxy-4-prop-1-en-2-ylperoxybutyl) 2-[(4-butan-2-ylphenyl)methyl-[2-(2-hydroxy-4-prop-1-en-2-ylperoxybutoxy)-2-oxoethyl]amino]acetate.
| Compound Name | (2-hydroxy-4-prop-1-en-2-ylperoxybutyl) 2-[(4-butan-2-ylphenyl)methyl-[2-(2-hydroxy-4-prop-1-en-2-ylperoxybutoxy)-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 58695554 |
| Molecular Formula | C29H45NO10 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | (2-hydroxy-4-prop-1-en-2-ylperoxybutyl) 2-[(4-butan-2-ylphenyl)methyl-[2-(2-hydroxy-4-prop-1-en-2-ylperoxybutoxy)-2-oxoethyl]amino]acetate |
| SMILES | C=C(C)OOCCC(O)COC(=O)CN(CC(=O)OCC(O)CCOOC(=C)C)Cc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C29H45NO10/c1-7-23(6)25-10-8-24(9-11-25)16-30(17-28(33)35-19-26(31)12-14-37-39-21(2)3)18-29(34)36-20-27(32)13-15-38-40-22(4)5/h8-11,23,26-27,31-32H,2,4,7,12-20H2,1,3,5-6H3 |
| InChIKey | SLQUYGLROUEJFV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|