C29H47N3O6 — CID 91456609
2-[(4-butan-2-ylphenyl)methyl-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethyl]amino]acetic acid;2-methyl-N-propan-2-ylbutanamide (PubChem CID 91456609) has the molecular formula C29H47N3O6 and a molecular weight of 533.71 g/mol. Its IUPAC name is 2-[(4-butan-2-ylphenyl)methyl-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethyl]amino]acetic acid;2-methyl-N-propan-2-ylbutanamide.
| Compound Name | 2-[(4-butan-2-ylphenyl)methyl-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethyl]amino]acetic acid;2-methyl-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 91456609 |
| Molecular Formula | C29H47N3O6 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | 2-[(4-butan-2-ylphenyl)methyl-[2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethyl]amino]acetic acid;2-methyl-N-propan-2-ylbutanamide |
| SMILES | C=C(C)C(=O)OCCNC(=O)CN(CC(=O)O)Cc1ccc(C(C)CC)cc1.CCC(C)C(=O)NC(C)C |
| InChI | InChI=1S/C21H30N2O5.C8H17NO/c1-5-16(4)18-8-6-17(7-9-18)12-23(14-20(25)26)13-19(24)22-10-11-28-21(27)15(2)3;1-5-7(4)8(10)9-6(2)3/h6-9,16H,2,5,10-14H2,1,3-4H3,(H,22,24)(H,25,26);6-7H,5H2,1-4H3,(H,9,10) |
| InChIKey | UDDFJCVGCQZPTB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|