C27H36N2O3 — CID 90928958
9-butan-2-ylcarbazole;2-(2-methylbutanoylamino)ethyl 2-methylprop-2-enoate (PubChem CID 90928958) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 9-butan-2-ylcarbazole;2-(2-methylbutanoylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 9-butan-2-ylcarbazole;2-(2-methylbutanoylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90928958 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 9-butan-2-ylcarbazole;2-(2-methylbutanoylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)C(C)CC.CCC(C)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C16H17N.C11H19NO3/c1-3-12(2)17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)17;1-5-9(4)10(13)12-6-7-15-11(14)8(2)3/h4-12H,3H2,1-2H3;9H,2,5-7H2,1,3-4H3,(H,12,13) |
| InChIKey | JWFPVRQPLQCMAR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|