C20H27N3O5 — CID 121325101
2-[[3-anilino-2-(butylcarbamoyl)-3-oxopropanoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 121325101) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[[3-anilino-2-(butylcarbamoyl)-3-oxopropanoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3-anilino-2-(butylcarbamoyl)-3-oxopropanoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121325101 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[[3-anilino-2-(butylcarbamoyl)-3-oxopropanoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)C(C(=O)NCCCC)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H27N3O5/c1-4-5-11-21-17(24)16(19(26)23-15-9-7-6-8-10-15)18(25)22-12-13-28-20(27)14(2)3/h6-10,16H,2,4-5,11-13H2,1,3H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | FBNPIPUCDHPAGF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|