C27H28N4O4 — CID 67678245
2-[[phenyl-[phenyl-(phenylcarbamoylamino)methyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 67678245) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[[phenyl-[phenyl-(phenylcarbamoylamino)methyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[phenyl-[phenyl-(phenylcarbamoylamino)methyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67678245 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[[phenyl-[phenyl-(phenylcarbamoylamino)methyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)N(c1ccccc1)C(NC(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N4O4/c1-20(2)25(32)35-19-18-28-27(34)31(23-16-10-5-11-17-23)24(21-12-6-3-7-13-21)30-26(33)29-22-14-8-4-9-15-22/h3-17,24H,1,18-19H2,2H3,(H,28,34)(H2,29,30,33) |
| InChIKey | WHIBJZYBJKPKPC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|