C22H31NO4 — CID 70478930
butyl 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]prop-2-enoate;styrene (PubChem CID 70478930) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is butyl 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]prop-2-enoate;styrene.
| Compound Name | butyl 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]prop-2-enoate;styrene |
|---|---|
| PubChem CID | 70478930 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | butyl 2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]prop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OCCNC=C(C)C(=O)OCCCC.C=Cc1ccccc1 |
| InChI | InChI=1S/C14H23NO4.C8H8/c1-5-6-8-18-14(17)12(4)10-15-7-9-19-13(16)11(2)3;1-2-8-6-4-3-5-7-8/h10,15H,2,5-9H2,1,3-4H3;2-7H,1H2 |
| InChIKey | GFMJCMXIKHWITK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|