About [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate
[4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate (PubChem CID 58340965) has the molecular formula C8H15NO5S
and a molecular weight of 239.29 g/mol. Its IUPAC name is [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate.
Molecular Properties
| Compound Name | [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate |
| PubChem CID | 58340965 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate |
| SMILES | [3H]SONC(=O)CC(C)OC(=O)COCC |
| InChI | InChI=1S/C8H15NO5S/c1-3-12-5-8(11)13-6(2)4-7(10)9-14-15/h6,15H,3-5H2,1-2H3,(H,9,10)/i/hT |
| InChIKey | PVZRFLBDOBKLBG-MNYXATJNSA-N |
| XLogP | 0.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate?
The IUPAC name of [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate (CID 58340965) is [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate.
What is the SMILES notation for [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate?
The canonical SMILES for [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate is [3H]SONC(=O)CC(C)OC(=O)COCC.
What is the InChIKey of [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate?
The InChIKey is PVZRFLBDOBKLBG-MNYXATJNSA-N. The full InChI is InChI=1S/C8H15NO5S/c1-3-12-5-8(11)13-6(2)4-7(10)9-14-15/h6,15H,3-5H2,1-2H3,(H,9,10)/i/hT.
What are the key properties of [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate?
[4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate has a molecular weight of 239.29 g/mol, XLogP of 0.24, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-oxo-4-(tritiosulfanyloxyamino)butan-2-yl] 2-ethoxyacetate is sourced from PubChem (CID 58340965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).