C88H90B6N9O16+6 — CID 58342249
CID 58342249 (PubChem CID 58342249) has the molecular formula C88H90B6N9O16+6 and a molecular weight of 1594.61 g/mol.
| Compound Name | CID 58342249 |
|---|---|
| PubChem CID | 58342249 |
| Molecular Formula | C88H90B6N9O16+6 |
| Molecular Weight | 1594.61 g/mol |
| Exact Mass | 1594.70 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)NCCCCC(=O)C(CCCCNC(=O)c1cc(-c2cc(-c3ccc[n+](Cc4ccccc4B(O)O)c3)c[n+](Cc3ccccc3O[B]O)c2)c[n+](Cc2ccccc2B(O)O)c1)NC(=O)c1cc(-c2cc(-c3ccc[n+](Cc4ccccc4O[B]O)c3)c[n+](Cc3ccccc3B(O)O)c2)c[n+](Cc2ccccc2O[B]O)c1 |
| InChI | InChI=1S/C88H87B6N9O16/c1-61(2)86(105)95-37-18-16-33-82(104)81(97-88(107)77-44-75(58-103(60-77)52-69-26-8-14-36-85(69)119-91-110)72-41-70(53-100(55-72)48-65-22-4-10-30-79(65)93(113)114)63-28-20-40-99(46-63)50-67-24-6-12-34-83(67)117-89-108)32-15-17-38-96-87(106)76-43-74(57-101(59-76)49-66-23-5-11-31-80(66)94(115)116)73-42-71(54-102(56-73)51-68-25-7-13-35-84(68)118-90-109)62-27-19-39-98(45-62)47-64-21-3-9-29-78(64)92(111)112/h3-14,19-31,34-36,39-46,53-60,81,108-116H,1,15-18,32-33,37-38,47-52H2,2H3/q+3/p+3 |
| InChIKey | FTUUJUARKABOBS-UHFFFAOYSA-Q |
| XLogP | 2.26 |
| TPSA | 337.41 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 119 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1594.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|