C29H30N4O4 — CID 58342439
N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-(4-pyridin-4-ylbutanoylamino)phenyl]ethynyl]benzamide (PubChem CID 58342439) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-(4-pyridin-4-ylbutanoylamino)phenyl]ethynyl]benzamide.
| Compound Name | N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-(4-pyridin-4-ylbutanoylamino)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 58342439 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-(4-pyridin-4-ylbutanoylamino)phenyl]ethynyl]benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CCCc3ccncc3)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C29H30N4O4/c1-20(30)28(26(35)19-34)33-29(37)24-11-7-22(8-12-24)5-6-23-9-13-25(14-10-23)32-27(36)4-2-3-21-15-17-31-18-16-21/h7-18,20,28,34H,2-4,19,30H2,1H3,(H,32,36)(H,33,37)/t20-,28+/m1/s1 |
| InChIKey | DISJYSKYEGPMHN-NGOKVRLYSA-N |
| XLogP | 2.45 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|