C30H29N3O7 — CID 58343352
N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-[[4-(3,4-dihydroxyphenyl)-4-oxobutanoyl]amino]phenyl]ethynyl]benzamide (PubChem CID 58343352) has the molecular formula C30H29N3O7 and a molecular weight of 543.58 g/mol. Its IUPAC name is N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-[[4-(3,4-dihydroxyphenyl)-4-oxobutanoyl]amino]phenyl]ethynyl]benzamide.
| Compound Name | N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-[[4-(3,4-dihydroxyphenyl)-4-oxobutanoyl]amino]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 58343352 |
| Molecular Formula | C30H29N3O7 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | N-[(3S,4R)-4-amino-1-hydroxy-2-oxopentan-3-yl]-4-[2-[4-[[4-(3,4-dihydroxyphenyl)-4-oxobutanoyl]amino]phenyl]ethynyl]benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CCC(=O)c3ccc(O)c(O)c3)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C30H29N3O7/c1-18(31)29(27(38)17-34)33-30(40)21-8-4-19(5-9-21)2-3-20-6-11-23(12-7-20)32-28(39)15-14-24(35)22-10-13-25(36)26(37)16-22/h4-13,16,18,29,34,36-37H,14-15,17,31H2,1H3,(H,32,39)(H,33,40)/t18-,29+/m1/s1 |
| InChIKey | HMPWMGIETRUMDJ-LBEKAKSKSA-N |
| XLogP | 2.11 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|