C14H14FNO3 — CID 58342482
1-[(4R)-2-(4-fluoro-3-prop-2-enylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]-2-hydroxyethanone (PubChem CID 58342482) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-[(4R)-2-(4-fluoro-3-prop-2-enylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]-2-hydroxyethanone.
| Compound Name | 1-[(4R)-2-(4-fluoro-3-prop-2-enylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 58342482 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-[(4R)-2-(4-fluoro-3-prop-2-enylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]-2-hydroxyethanone |
| SMILES | C=CCc1cc(C2=N[C@@H](C(=O)CO)CO2)ccc1F |
| InChI | InChI=1S/C14H14FNO3/c1-2-3-9-6-10(4-5-11(9)15)14-16-12(8-19-14)13(18)7-17/h2,4-6,12,17H,1,3,7-8H2/t12-/m1/s1 |
| InChIKey | COLSPEJAFNNAED-GFCCVEGCSA-N |
| XLogP | 1.26 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|