C18H20F2O3S — CID 58344098
6-[4-(2,4-difluorophenyl)phenyl]sulfonylhexan-1-ol (PubChem CID 58344098) has the molecular formula C18H20F2O3S and a molecular weight of 354.42 g/mol. Its IUPAC name is 6-[4-(2,4-difluorophenyl)phenyl]sulfonylhexan-1-ol.
| Compound Name | 6-[4-(2,4-difluorophenyl)phenyl]sulfonylhexan-1-ol |
|---|---|
| PubChem CID | 58344098 |
| Molecular Formula | C18H20F2O3S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6-[4-(2,4-difluorophenyl)phenyl]sulfonylhexan-1-ol |
| SMILES | O=S(=O)(CCCCCCO)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H20F2O3S/c19-15-7-10-17(18(20)13-15)14-5-8-16(9-6-14)24(22,23)12-4-2-1-3-11-21/h5-10,13,21H,1-4,11-12H2 |
| InChIKey | AGEHEJQSGBUWFZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|