C15H11F3O4S — CID 58345902
methyl 3-[(2,5-difluorophenyl)sulfanylperoxymethyl]-4-fluorobenzoate (PubChem CID 58345902) has the molecular formula C15H11F3O4S and a molecular weight of 344.31 g/mol. Its IUPAC name is methyl 3-[(2,5-difluorophenyl)sulfanylperoxymethyl]-4-fluorobenzoate.
| Compound Name | methyl 3-[(2,5-difluorophenyl)sulfanylperoxymethyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 58345902 |
| Molecular Formula | C15H11F3O4S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | methyl 3-[(2,5-difluorophenyl)sulfanylperoxymethyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(COOSc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C15H11F3O4S/c1-20-15(19)9-2-4-12(17)10(6-9)8-21-22-23-14-7-11(16)3-5-13(14)18/h2-7H,8H2,1H3 |
| InChIKey | YHTQHJSQQCWKHX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|