C47H48N6O6 — CID 58348778
1-O-benzyl 4-O-tert-butyl (2S)-2-[6-[2-[2-[(2S)-1-phenylmethoxycarbonylpiperidin-2-yl]-3H-indol-6-yl]ethynyl]-1H-benzimidazol-2-yl]piperazine-1,4-dicarboxylate (PubChem CID 58348778) has the molecular formula C47H48N6O6 and a molecular weight of 792.94 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl (2S)-2-[6-[2-[2-[(2S)-1-phenylmethoxycarbonylpiperidin-2-yl]-3H-indol-6-yl]ethynyl]-1H-benzimidazol-2-yl]piperazine-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-[6-[2-[2-[(2S)-1-phenylmethoxycarbonylpiperidin-2-yl]-3H-indol-6-yl]ethynyl]-1H-benzimidazol-2-yl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58348778 |
| Molecular Formula | C47H48N6O6 |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.36 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-[6-[2-[2-[(2S)-1-phenylmethoxycarbonylpiperidin-2-yl]-3H-indol-6-yl]ethynyl]-1H-benzimidazol-2-yl]piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)[C@H](c2nc3ccc(C#Cc4ccc5c(c4)N=C([C@@H]4CCCCN4C(=O)OCc4ccccc4)C5)cc3[nH]2)C1 |
| InChI | InChI=1S/C47H48N6O6/c1-47(2,3)59-44(54)51-24-25-53(46(56)58-31-35-14-8-5-9-15-35)42(29-51)43-49-37-22-20-33(27-39(37)50-43)18-17-32-19-21-36-28-40(48-38(36)26-32)41-16-10-11-23-52(41)45(55)57-30-34-12-6-4-7-13-34/h4-9,12-15,19-22,26-27,41-42H,10-11,16,23-25,28-31H2,1-3H3,(H,49,50)/t41-,42-/m0/s1 |
| InChIKey | NHERIFYKZNAOKO-COCZKOEFSA-N |
| XLogP | 8.71 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|