C33H49Cl2FNOPRu+2 — CID 58350369
dichloro-[[5-fluoro-2-[(2-methyloxonioanilino)methyl]phenyl]methylidene]ruthenium;tricyclohexylphosphanium (PubChem CID 58350369) has the molecular formula C33H49Cl2FNOPRu+2 and a molecular weight of 697.71 g/mol. Its IUPAC name is dichloro-[[5-fluoro-2-[(2-methyloxonioanilino)methyl]phenyl]methylidene]ruthenium;tricyclohexylphosphanium.
| Compound Name | dichloro-[[5-fluoro-2-[(2-methyloxonioanilino)methyl]phenyl]methylidene]ruthenium;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 58350369 |
| Molecular Formula | C33H49Cl2FNOPRu+2 |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 697.19 |
| IUPAC Name | dichloro-[[5-fluoro-2-[(2-methyloxonioanilino)methyl]phenyl]methylidene]ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.C[OH+]c1ccccc1NCc1ccc(F)cc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C18H33P.C15H14FNO.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-11-9-13(16)8-7-12(11)10-17-14-5-3-4-6-15(14)18-2;;;/h16-18H,1-15H2;1,3-9,17H,10H2,2H3;2*1H;/q;;;;+2 |
| InChIKey | RQBIOCVCUMXSHL-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 24.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|