C21H37IO4Si — CID 58351204
2-[(2R,3S,4R,4aR,8aS)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde (PubChem CID 58351204) has the molecular formula C21H37IO4Si and a molecular weight of 508.51 g/mol. Its IUPAC name is 2-[(2R,3S,4R,4aR,8aS)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S,4R,4aR,8aS)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 58351204 |
| Molecular Formula | C21H37IO4Si |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-[(2R,3S,4R,4aR,8aS)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetaldehyde |
| SMILES | C[C@@H]1[C@H](C)[C@H]([C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)O[C@H]2CCC(CC=O)O[C@H]12 |
| InChI | InChI=1S/C21H37IO4Si/c1-14-15(2)20(18(10-12-22)26-27(6,7)21(3,4)5)25-17-9-8-16(11-13-23)24-19(14)17/h10,12-20H,8-9,11H2,1-7H3/b12-10+/t14-,15+,16?,17+,18+,19-,20-/m1/s1 |
| InChIKey | NNNWYYNSNJCAKY-RZYUBDLSSA-N |
| XLogP | 5.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|