C12H23FO3 — CID 58351928
(2R,3R,4S,5R)-4-fluoro-5-methyl-2,3-di(propan-2-yloxy)oxane (PubChem CID 58351928) has the molecular formula C12H23FO3 and a molecular weight of 234.31 g/mol. Its IUPAC name is (2R,3R,4S,5R)-4-fluoro-5-methyl-2,3-di(propan-2-yloxy)oxane.
| Compound Name | (2R,3R,4S,5R)-4-fluoro-5-methyl-2,3-di(propan-2-yloxy)oxane |
|---|---|
| PubChem CID | 58351928 |
| Molecular Formula | C12H23FO3 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2R,3R,4S,5R)-4-fluoro-5-methyl-2,3-di(propan-2-yloxy)oxane |
| SMILES | CC(C)O[C@H]1OC[C@@H](C)[C@H](F)[C@@H]1OC(C)C |
| InChI | InChI=1S/C12H23FO3/c1-7(2)15-11-10(13)9(5)6-14-12(11)16-8(3)4/h7-12H,6H2,1-5H3/t9-,10+,11+,12-/m1/s1 |
| InChIKey | HCGDWFRNCRAKCG-NOOOWODRSA-N |
| XLogP | 2.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |