C10H8F7O7S- — CID 58352285
1,1-difluoro-2-[2,2,4,4,4-pentafluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxyethanesulfonate (PubChem CID 58352285) has the molecular formula C10H8F7O7S- and a molecular weight of 405.22 g/mol. Its IUPAC name is 1,1-difluoro-2-[2,2,4,4,4-pentafluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[2,2,4,4,4-pentafluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 58352285 |
| Molecular Formula | C10H8F7O7S- |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 1,1-difluoro-2-[2,2,4,4,4-pentafluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxyethanesulfonate |
| SMILES | C=C(C)C(=O)OC(C(F)(F)F)C(F)(F)C(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H9F7O7S/c1-4(2)5(18)24-6(10(15,16)17)9(13,14)7(19)23-3-8(11,12)25(20,21)22/h6H,1,3H2,2H3,(H,20,21,22)/p-1 |
| InChIKey | TZYUFESSIRNBDK-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|