C28H31Cl2N3O3 — CID 58352864
CID 58352864 (PubChem CID 58352864) has the molecular formula C28H31Cl2N3O3 and a molecular weight of 528.48 g/mol.
| Compound Name | CID 58352864 |
|---|---|
| PubChem CID | 58352864 |
| Molecular Formula | C28H31Cl2N3O3 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | — |
| SMILES | [CH]CNC(=O)c1ccc([C@@H](C)N2C(=O)C(c3cc(Cl)cc(Cl)c3)=NC23CCOC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C28H31Cl2N3O3/c1-6-31-25(34)19-9-7-18(8-10-19)17(2)33-26(35)24(20-13-21(29)15-22(30)14-20)32-28(33)11-12-36-23(16-28)27(3,4)5/h1,7-10,13-15,17,23H,6,11-12,16H2,2-5H3,(H,31,34)/t17-,23?,28?/m1/s1 |
| InChIKey | JZKRTMBVHUJYAB-BTZRHWHPSA-N |
| XLogP | 5.75 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |