C23H35N5O2 — CID 58355664
5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyl-N-[(3S)-piperidin-3-yl]triazole-4-carboxamide (PubChem CID 58355664) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyl-N-[(3S)-piperidin-3-yl]triazole-4-carboxamide.
| Compound Name | 5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyl-N-[(3S)-piperidin-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 58355664 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyl-N-[(3S)-piperidin-3-yl]triazole-4-carboxamide |
| SMILES | COCCCCc1c(C(=O)N(CC(C)C)[C@H]2CCCNC2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C23H35N5O2/c1-18(2)17-27(20-12-9-14-24-16-20)23(29)22-21(13-7-8-15-30-3)28(26-25-22)19-10-5-4-6-11-19/h4-6,10-11,18,20,24H,7-9,12-17H2,1-3H3/t20-/m0/s1 |
| InChIKey | XMNIGKPWYNIZEM-FQEVSTJZSA-N |
| XLogP | 3.09 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|