C25H38ClN5O3 — CID 67321195
N-[(3S,5R)-5-acetylpiperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyltriazole-4-carboxamide;hydrochloride (PubChem CID 67321195) has the molecular formula C25H38ClN5O3 and a molecular weight of 492.06 g/mol. Its IUPAC name is N-[(3S,5R)-5-acetylpiperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[(3S,5R)-5-acetylpiperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67321195 |
| Molecular Formula | C25H38ClN5O3 |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | N-[(3S,5R)-5-acetylpiperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)-1-phenyltriazole-4-carboxamide;hydrochloride |
| SMILES | COCCCCc1c(C(=O)N(CC(C)C)[C@@H]2CNC[C@H](C(C)=O)C2)nnn1-c1ccccc1.Cl |
| InChI | InChI=1S/C25H37N5O3.ClH/c1-18(2)17-29(22-14-20(19(3)31)15-26-16-22)25(32)24-23(12-8-9-13-33-4)30(28-27-24)21-10-6-5-7-11-21;/h5-7,10-11,18,20,22,26H,8-9,12-17H2,1-4H3;1H/t20-,22+;/m1./s1 |
| InChIKey | SDYGNNQAJXWYOY-LBPAWUGGSA-N |
| XLogP | 3.32 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|