C31H46FN5O7 — CID 68665130
but-2-enedioic acid;1-(2-fluorophenyl)-N-[(3S,5R)-5-(1-hydroxy-2-methylpropyl)piperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)triazole-4-carboxamide (PubChem CID 68665130) has the molecular formula C31H46FN5O7 and a molecular weight of 619.74 g/mol. Its IUPAC name is but-2-enedioic acid;1-(2-fluorophenyl)-N-[(3S,5R)-5-(1-hydroxy-2-methylpropyl)piperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)triazole-4-carboxamide.
| Compound Name | but-2-enedioic acid;1-(2-fluorophenyl)-N-[(3S,5R)-5-(1-hydroxy-2-methylpropyl)piperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 68665130 |
| Molecular Formula | C31H46FN5O7 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | but-2-enedioic acid;1-(2-fluorophenyl)-N-[(3S,5R)-5-(1-hydroxy-2-methylpropyl)piperidin-3-yl]-5-(4-methoxybutyl)-N-(2-methylpropyl)triazole-4-carboxamide |
| SMILES | COCCCCc1c(C(=O)N(CC(C)C)[C@@H]2CNC[C@H](C(O)C(C)C)C2)nnn1-c1ccccc1F.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C27H42FN5O3.C4H4O4/c1-18(2)17-32(21-14-20(15-29-16-21)26(34)19(3)4)27(35)25-24(12-8-9-13-36-5)33(31-30-25)23-11-7-6-10-22(23)28;5-3(6)1-2-4(7)8/h6-7,10-11,18-21,26,29,34H,8-9,12-17H2,1-5H3;1-2H,(H,5,6)(H,7,8)/t20-,21+,26?;/m1./s1 |
| InChIKey | GANFTSILCURDMQ-JNWSPIIOSA-N |
| XLogP | 3.18 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|