C34H44N2O5S2 — CID 58355854
5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[4-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]methoxyimino]cyclohexyl]amino]thiophene-2-carboxylic acid (PubChem CID 58355854) has the molecular formula C34H44N2O5S2 and a molecular weight of 624.87 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[4-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]methoxyimino]cyclohexyl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[4-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]methoxyimino]cyclohexyl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58355854 |
| Molecular Formula | C34H44N2O5S2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[4-[[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]methoxyimino]cyclohexyl]amino]thiophene-2-carboxylic acid |
| SMILES | C=S(C)(=O)c1ccc(CON=C2CCC(N(C(=O)C3CCC(C)CC3)c3cc(C#CC(C)(C)C)sc3C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C34H44N2O5S2/c1-23-7-11-25(12-8-23)32(37)36(30-21-28(19-20-34(2,3)4)42-31(30)33(38)39)27-15-13-26(14-16-27)35-41-22-24-9-17-29(18-10-24)43(5,6)40/h9-10,17-18,21,23,25,27H,5,7-8,11-16,22H2,1-4,6H3,(H,38,39)/b35-26- |
| InChIKey | WEHQNPHXWVVPEG-JYUHDHNASA-N |
| XLogP | 7.22 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|