C25H35N3O4S — CID 88928550
5-tert-butyl-3-[[4-(cyanomethoxyimino)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 88928550) has the molecular formula C25H35N3O4S and a molecular weight of 473.64 g/mol. Its IUPAC name is 5-tert-butyl-3-[[4-(cyanomethoxyimino)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-tert-butyl-3-[[4-(cyanomethoxyimino)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 88928550 |
| Molecular Formula | C25H35N3O4S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 5-tert-butyl-3-[[4-(cyanomethoxyimino)cyclohexyl]-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | CC1CCC(C(=O)N(c2cc(C(C)(C)C)sc2C(=O)O)C2CCC(=NOCC#N)CC2)CC1 |
| InChI | InChI=1S/C25H35N3O4S/c1-16-5-7-17(8-6-16)23(29)28(19-11-9-18(10-12-19)27-32-14-13-26)20-15-21(25(2,3)4)33-22(20)24(30)31/h15-17,19H,5-12,14H2,1-4H3,(H,30,31)/b27-18- |
| InChIKey | ZVBDQQIUWZJKMC-IMRQLAEWSA-N |
| XLogP | 5.74 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|