C32H40N2O5S — CID 11963274
3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-[(4E)-4-phenylmethoxyiminocyclohexen-1-yl]thiophene-2-carboxylic acid (PubChem CID 11963274) has the molecular formula C32H40N2O5S and a molecular weight of 564.75 g/mol. Its IUPAC name is 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-[(4E)-4-phenylmethoxyiminocyclohexen-1-yl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-[(4E)-4-phenylmethoxyiminocyclohexen-1-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 11963274 |
| Molecular Formula | C32H40N2O5S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-5-[(4E)-4-phenylmethoxyiminocyclohexen-1-yl]thiophene-2-carboxylic acid |
| SMILES | CC1CCC(C(=O)N(c2cc(C3=CC/C(=N/OCc4ccccc4)CC3)sc2C(=O)O)C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C32H40N2O5S/c1-21-7-9-24(10-8-21)31(36)34(26-15-17-27(35)18-16-26)28-19-29(40-30(28)32(37)38)23-11-13-25(14-12-23)33-39-20-22-5-3-2-4-6-22/h2-6,11,19,21,24,26-27,35H,7-10,12-18,20H2,1H3,(H,37,38)/b33-25- |
| InChIKey | BWSQKLRZLXODAO-IVQJCJPDSA-N |
| XLogP | 7.05 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|