C13H22N3OP — CID 583559
N-[3,4-dihydro-1H-isoquinolin-2-yl(dimethylamino)phosphoryl]-N-methylmethanamine (PubChem CID 583559) has the molecular formula C13H22N3OP and a molecular weight of 267.31 g/mol. Its IUPAC name is N-[3,4-dihydro-1H-isoquinolin-2-yl(dimethylamino)phosphoryl]-N-methylmethanamine.
| Compound Name | N-[3,4-dihydro-1H-isoquinolin-2-yl(dimethylamino)phosphoryl]-N-methylmethanamine |
|---|---|
| PubChem CID | 583559 |
| Molecular Formula | C13H22N3OP |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[3,4-dihydro-1H-isoquinolin-2-yl(dimethylamino)phosphoryl]-N-methylmethanamine |
| SMILES | CN(C)P(=O)(N(C)C)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H22N3OP/c1-14(2)18(17,15(3)4)16-10-9-12-7-5-6-8-13(12)11-16/h5-8H,9-11H2,1-4H3 |
| InChIKey | YFULETRRRHUSGX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|