C8H14O2 — CID 58359319
(3S,4R,5R)-5-(deuteriomethyl)-4-methyl-1,6-dioxaspiro[2.5]octane (PubChem CID 58359319) has the molecular formula C8H14O2 and a molecular weight of 143.20 g/mol. Its IUPAC name is (3S,4R,5R)-5-(deuteriomethyl)-4-methyl-1,6-dioxaspiro[2.5]octane.
| Compound Name | (3S,4R,5R)-5-(deuteriomethyl)-4-methyl-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 58359319 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (3S,4R,5R)-5-(deuteriomethyl)-4-methyl-1,6-dioxaspiro[2.5]octane |
| SMILES | [2H]C[C@H]1OCC[C@@]2(CO2)[C@@H]1C |
| InChI | InChI=1S/C8H14O2/c1-6-7(2)9-4-3-8(6)5-10-8/h6-7H,3-5H2,1-2H3/t6-,7-,8-/m1/s1/i2D |
| InChIKey | ZYTKRHKGVBFDHD-WSMKMTLZSA-N |
| XLogP | 1.20 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|