C30H34F6N6O4S2 — CID 58359641
1-N,3-N-bis[3-amino-2-[2-(methylamino)ethylsulfanyl]-5-(trifluoromethyl)phenyl]-4,6-dimethoxybenzene-1,3-dicarboxamide (PubChem CID 58359641) has the molecular formula C30H34F6N6O4S2 and a molecular weight of 720.76 g/mol. Its IUPAC name is 1-N,3-N-bis[3-amino-2-[2-(methylamino)ethylsulfanyl]-5-(trifluoromethyl)phenyl]-4,6-dimethoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[3-amino-2-[2-(methylamino)ethylsulfanyl]-5-(trifluoromethyl)phenyl]-4,6-dimethoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58359641 |
| Molecular Formula | C30H34F6N6O4S2 |
| Molecular Weight | 720.76 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | 1-N,3-N-bis[3-amino-2-[2-(methylamino)ethylsulfanyl]-5-(trifluoromethyl)phenyl]-4,6-dimethoxybenzene-1,3-dicarboxamide |
| SMILES | CNCCSc1c(N)cc(C(F)(F)F)cc1NC(=O)c1cc(C(=O)Nc2cc(C(F)(F)F)cc(N)c2SCCNC)c(OC)cc1OC |
| InChI | InChI=1S/C30H34F6N6O4S2/c1-39-5-7-47-25-19(37)9-15(29(31,32)33)11-21(25)41-27(43)17-13-18(24(46-4)14-23(17)45-3)28(44)42-22-12-16(30(34,35)36)10-20(38)26(22)48-8-6-40-2/h9-14,39-40H,5-8,37-38H2,1-4H3,(H,41,43)(H,42,44) |
| InChIKey | YTKKCJWXIXMTII-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|