C20H22BrNO7 — CID 58360139
(3,4,5-trimethoxyphenyl) 3-(2-bromopropanoylamino)-4-(hydroxymethyl)benzoate (PubChem CID 58360139) has the molecular formula C20H22BrNO7 and a molecular weight of 468.30 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) 3-(2-bromopropanoylamino)-4-(hydroxymethyl)benzoate.
| Compound Name | (3,4,5-trimethoxyphenyl) 3-(2-bromopropanoylamino)-4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 58360139 |
| Molecular Formula | C20H22BrNO7 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) 3-(2-bromopropanoylamino)-4-(hydroxymethyl)benzoate |
| SMILES | COc1cc(OC(=O)c2ccc(CO)c(NC(=O)C(C)Br)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22BrNO7/c1-11(21)19(24)22-15-7-12(5-6-13(15)10-23)20(25)29-14-8-16(26-2)18(28-4)17(9-14)27-3/h5-9,11,23H,10H2,1-4H3,(H,22,24) |
| InChIKey | XIHBAIRUAKUINR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|