C18H21N5O3 — CID 58361773
(5S)-3-[4-(1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 58361773) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is (5S)-3-[4-(1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58361773 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (5S)-3-[4-(1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | CN1CCN(c2ccc(N3C[C@H](CCc4ccon4)OC3=O)cc2)C=N1 |
| InChI | InChI=1S/C18H21N5O3/c1-21-9-10-22(13-19-21)15-3-5-16(6-4-15)23-12-17(26-18(23)24)7-2-14-8-11-25-20-14/h3-6,8,11,13,17H,2,7,9-10,12H2,1H3/t17-/m0/s1 |
| InChIKey | DYXZRROTTUVHAY-KRWDZBQOSA-N |
| XLogP | 2.33 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |