C18H21N5O3S — CID 45139159
O-methyl N-[[(5S)-2-oxo-3-[4-(1-prop-2-ynyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 45139159) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is O-methyl N-[[(5S)-2-oxo-3-[4-(1-prop-2-ynyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[(5S)-2-oxo-3-[4-(1-prop-2-ynyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 45139159 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | O-methyl N-[[(5S)-2-oxo-3-[4-(1-prop-2-ynyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | C#CCN1CCN(c2ccc(N3C[C@H](CNC(=S)OC)OC3=O)cc2)C=N1 |
| InChI | InChI=1S/C18H21N5O3S/c1-3-8-22-10-9-21(13-20-22)14-4-6-15(7-5-14)23-12-16(26-18(23)24)11-19-17(27)25-2/h1,4-7,13,16H,8-12H2,2H3,(H,19,27)/t16-/m0/s1 |
| InChIKey | YEKVGISJVRHOIR-INIZCTEOSA-N |
| XLogP | 1.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|