C17H17Cl2FN6O3 — CID 75096277
2,2-dichloro-N-[[3-[4-[1-(cyanomethyl)-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 75096277) has the molecular formula C17H17Cl2FN6O3 and a molecular weight of 443.27 g/mol. Its IUPAC name is 2,2-dichloro-N-[[3-[4-[1-(cyanomethyl)-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2-dichloro-N-[[3-[4-[1-(cyanomethyl)-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 75096277 |
| Molecular Formula | C17H17Cl2FN6O3 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 2,2-dichloro-N-[[3-[4-[1-(cyanomethyl)-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | N#CCN1CCN(c2ccc(N3CC(CNC(=O)C(Cl)Cl)OC3=O)cc2F)C=N1 |
| InChI | InChI=1S/C17H17Cl2FN6O3/c18-15(19)16(27)22-8-12-9-26(17(28)29-12)11-1-2-14(13(20)7-11)24-5-6-25(4-3-21)23-10-24/h1-2,7,10,12,15H,4-6,8-9H2,(H,22,27) |
| InChIKey | SQLRQPHOJNEGHF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|