C15H21N5O3S — CID 11552073
O-methyl N-[[(5S)-2-oxo-3-(6-piperazin-1-yl-3-pyridinyl)-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 11552073) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is O-methyl N-[[(5S)-2-oxo-3-(6-piperazin-1-yl-3-pyridinyl)-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[(5S)-2-oxo-3-(6-piperazin-1-yl-3-pyridinyl)-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 11552073 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | O-methyl N-[[(5S)-2-oxo-3-(6-piperazin-1-yl-3-pyridinyl)-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | COC(=S)NC[C@H]1CN(c2ccc(N3CCNCC3)nc2)C(=O)O1 |
| InChI | InChI=1S/C15H21N5O3S/c1-22-14(24)18-9-12-10-20(15(21)23-12)11-2-3-13(17-8-11)19-6-4-16-5-7-19/h2-3,8,12,16H,4-7,9-10H2,1H3,(H,18,24)/t12-/m0/s1 |
| InChIKey | YXLURAZYAGODTL-LBPRGKRZSA-N |
| XLogP | 0.34 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|