C21H23ClFN5O6 — CID 123858796
(2-chloro-2-oxoethyl) acetate;(5S)-3-[4-(5,6-dihydro-1H-1,2,4-triazin-4-yl)-3-fluorophenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 123858796) has the molecular formula C21H23ClFN5O6 and a molecular weight of 495.90 g/mol. Its IUPAC name is (2-chloro-2-oxoethyl) acetate;(5S)-3-[4-(5,6-dihydro-1H-1,2,4-triazin-4-yl)-3-fluorophenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | (2-chloro-2-oxoethyl) acetate;(5S)-3-[4-(5,6-dihydro-1H-1,2,4-triazin-4-yl)-3-fluorophenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123858796 |
| Molecular Formula | C21H23ClFN5O6 |
| Molecular Weight | 495.90 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (2-chloro-2-oxoethyl) acetate;(5S)-3-[4-(5,6-dihydro-1H-1,2,4-triazin-4-yl)-3-fluorophenyl]-5-[2-(1,2-oxazol-3-yl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | CC(=O)OCC(=O)Cl.O=C1O[C@@H](CCc2ccon2)CN1c1ccc(N2C=NNCC2)c(F)c1 |
| InChI | InChI=1S/C17H18FN5O3.C4H5ClO3/c18-15-9-13(2-4-16(15)22-7-6-19-20-11-22)23-10-14(26-17(23)24)3-1-12-5-8-25-21-12;1-3(6)8-2-4(5)7/h2,4-5,8-9,11,14,19H,1,3,6-7,10H2;2H2,1H3/t14-;/m0./s1 |
| InChIKey | YDSKPZHKNSPWLJ-UQKRIMTDSA-N |
| XLogP | 2.44 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.90 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|