C27H30N2O4S — CID 58362969
(11S,17R)-N-(1,3-benzothiazol-2-yl)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 58362969) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is (11S,17R)-N-(1,3-benzothiazol-2-yl)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (11S,17R)-N-(1,3-benzothiazol-2-yl)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 58362969 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (11S,17R)-N-(1,3-benzothiazol-2-yl)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C27H30N2O4S/c1-25-11-9-16(30)13-15(25)7-8-17-18-10-12-27(33,26(18,2)14-20(31)22(17)25)23(32)29-24-28-19-5-3-4-6-21(19)34-24/h3-6,9,11,13,17-18,20,22,31,33H,7-8,10,12,14H2,1-2H3,(H,28,29,32)/t17?,18?,20?,22?,25?,26?,27-/m0/s1 |
| InChIKey | GBCNGRQDTBHSIW-CHVUIPLJSA-N |
| XLogP | 4.24 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |